C21H21NO2S — CID 102168239
6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene (PubChem CID 102168239) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene.
| Compound Name | 6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene |
|---|---|
| PubChem CID | 102168239 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C=CCC2C=C3c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO2S/c1-16-10-12-20(13-11-16)25(23,24)22-15-18-8-5-9-19(22)14-21(18)17-6-3-2-4-7-17/h2-8,10-14,18-19H,9,15H2,1H3 |
| InChIKey | DYVHXWLNQUUXRK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|