About 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene
8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene (PubChem CID 102168243) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene.
Molecular Properties
| Compound Name | 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene |
| PubChem CID | 102168243 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene |
| SMILES | C/C=C/C1C=CC2COC1C=C2c1ccccc1 |
| InChI | InChI=1S/C17H18O/c1-2-6-14-9-10-15-12-18-17(14)11-16(15)13-7-4-3-5-8-13/h2-11,14-15,17H,12H2,1H3/b6-2+ |
| InChIKey | WFDMIVRAAXKKAD-QHHAFSJGSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene?
The IUPAC name of 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene (CID 102168243) is 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene.
What is the SMILES notation for 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene?
The canonical SMILES for 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene is C/C=C/C1C=CC2COC1C=C2c1ccccc1.
What is the InChIKey of 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene?
The InChIKey is WFDMIVRAAXKKAD-QHHAFSJGSA-N. The full InChI is InChI=1S/C17H18O/c1-2-6-14-9-10-15-12-18-17(14)11-16(15)13-7-4-3-5-8-13/h2-11,14-15,17H,12H2,1H3/b6-2+.
What are the key properties of 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene?
8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene has a molecular weight of 238.33 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyl-4-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.2]nona-2,8-diene is sourced from PubChem (CID 102168243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).