C16H28N6 — CID 102168456
1,3,4,5-tetramethyl-N-[2-[(1,3,4,5-tetramethylimidazol-2-ylidene)amino]ethyl]imidazol-2-imine (PubChem CID 102168456) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-N-[2-[(1,3,4,5-tetramethylimidazol-2-ylidene)amino]ethyl]imidazol-2-imine.
| Compound Name | 1,3,4,5-tetramethyl-N-[2-[(1,3,4,5-tetramethylimidazol-2-ylidene)amino]ethyl]imidazol-2-imine |
|---|---|
| PubChem CID | 102168456 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1,3,4,5-tetramethyl-N-[2-[(1,3,4,5-tetramethylimidazol-2-ylidene)amino]ethyl]imidazol-2-imine |
| SMILES | Cc1c(C)n(C)c(=NCCN=c2n(C)c(C)c(C)n2C)n1C |
| InChI | InChI=1S/C16H28N6/c1-11-12(2)20(6)15(19(11)5)17-9-10-18-16-21(7)13(3)14(4)22(16)8/h9-10H2,1-8H3 |
| InChIKey | KTXAKLVUZKWZSM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|