C24H25N3O2S2 — CID 102168469
N-[(1S)-1-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]butyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 102168469) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is N-[(1S)-1-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]butyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1S)-1-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]butyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 102168469 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[(1S)-1-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]butyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | CCC[C@H](NS(=O)(=O)c1ccc(C)cc1C)[C@H]1CSc2ccccc2C1=C(C#N)C#N |
| InChI | InChI=1S/C24H25N3O2S2/c1-4-7-21(27-31(28,29)23-11-10-16(2)12-17(23)3)20-15-30-22-9-6-5-8-19(22)24(20)18(13-25)14-26/h5-6,8-12,20-21,27H,4,7,15H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | JGBMDCJUWWCRTP-RTWAWAEBSA-N |
| XLogP | 4.97 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|