C41H37N3O4 — CID 102168470
N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxamide (PubChem CID 102168470) has the molecular formula C41H37N3O4 and a molecular weight of 635.76 g/mol. Its IUPAC name is N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxamide.
| Compound Name | N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 102168470 |
| Molecular Formula | C41H37N3O4 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxamide |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=O)c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C41H37N3O4/c1-3-24-23-44-19-17-26(24)21-35(44)39(31-16-18-42-34-14-13-28(48-2)22-32(31)34)43-41(47)33-20-27-9-5-7-11-30(27)38(40(33)46)37-29-10-6-4-8-25(29)12-15-36(37)45/h3-16,18,20,22,24,26,35,39,45-46H,1,17,19,21,23H2,2H3,(H,43,47)/t24?,26?,35-,39-/m0/s1 |
| InChIKey | AXHJCAGJRXZTBG-MZKMCRDASA-N |
| XLogP | 8.00 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|