About [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate
[(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate (PubChem CID 102168687) has the molecular formula C6H9NO4
and a molecular weight of 159.14 g/mol. Its IUPAC name is [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate.
Molecular Properties
| Compound Name | [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate |
| PubChem CID | 102168687 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate |
| SMILES | N[C@H]1CO[C@H](C=O)[C@@H]1OC=O |
| InChI | InChI=1S/C6H9NO4/c7-4-2-10-5(1-8)6(4)11-3-9/h1,3-6H,2,7H2/t4-,5+,6+/m0/s1 |
| InChIKey | VVXAPYIXOBNMKI-KVQBGUIXSA-N |
| XLogP | -1.55 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate?
The IUPAC name of [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate (CID 102168687) is [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate.
What is the SMILES notation for [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate?
The canonical SMILES for [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate is N[C@H]1CO[C@H](C=O)[C@@H]1OC=O.
What is the InChIKey of [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate?
The InChIKey is VVXAPYIXOBNMKI-KVQBGUIXSA-N. The full InChI is InChI=1S/C6H9NO4/c7-4-2-10-5(1-8)6(4)11-3-9/h1,3-6H,2,7H2/t4-,5+,6+/m0/s1.
What are the key properties of [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate?
[(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate has a molecular weight of 159.14 g/mol, XLogP of -1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R,4S)-4-amino-2-formyloxolan-3-yl] formate is sourced from PubChem (CID 102168687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).