C18H15N3 — CID 102168714
4-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzonitrile (PubChem CID 102168714) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzonitrile.
| Compound Name | 4-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 102168714 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzonitrile |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H15N3/c1-13-18(16-10-8-15(12-19)9-11-16)14(2)21(20-13)17-6-4-3-5-7-17/h3-11H,1-2H3 |
| InChIKey | HNXBFSRUISEFSF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |