C29H39NO3 — CID 102169033
(3E,5E,7E,11E,13E,15E,17E)-9,10-dihydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one (PubChem CID 102169033) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is (3E,5E,7E,11E,13E,15E,17E)-9,10-dihydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one.
| Compound Name | (3E,5E,7E,11E,13E,15E,17E)-9,10-dihydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 102169033 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | (3E,5E,7E,11E,13E,15E,17E)-9,10-dihydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
| SMILES | CCC/C=C/C=C/CC1C/C=C/C=C(C)/C=C/C=C/C(O)C(O)/C=C(C)/C=C/C=C/C(=O)N1 |
| InChI | InChI=1S/C29H39NO3/c1-4-5-6-7-8-9-19-26-20-13-10-16-24(2)17-11-14-21-27(31)28(32)23-25(3)18-12-15-22-29(33)30-26/h6-18,21-23,26-28,31-32H,4-5,19-20H2,1-3H3,(H,30,33)/b7-6+,9-8+,13-10+,17-11+,18-12+,21-14+,22-15+,24-16+,25-23+ |
| InChIKey | QUZNSWBEDCHESP-KLYFDHOZSA-N |
| XLogP | 5.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|