C27H32Cl3NO4Si — CID 102169219
N-[(2S,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]-2,2,2-trichloroacetamide (PubChem CID 102169219) has the molecular formula C27H32Cl3NO4Si and a molecular weight of 569.00 g/mol. Its IUPAC name is N-[(2S,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(2S,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 102169219 |
| Molecular Formula | C27H32Cl3NO4Si |
| Molecular Weight | 569.00 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | N-[(2S,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]-2,2,2-trichloroacetamide |
| SMILES | C=CCO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H32Cl3NO4Si/c1-5-18-33-24-23(31-25(32)27(28,29)30)17-16-20(35-24)19-34-36(26(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h5-17,20,23-24H,1,18-19H2,2-4H3,(H,31,32)/t20-,23-,24-/m0/s1 |
| InChIKey | TYGYDQOFVDVABG-OYDLWJJNSA-N |
| XLogP | 4.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|