C21H25N3O4S — CID 102169281
N-(1,3-diethyl-2,4-dioxo-6-prop-2-enylpyrimidin-5-yl)-4-methyl-N-prop-2-ynylbenzenesulfonamide (PubChem CID 102169281) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(1,3-diethyl-2,4-dioxo-6-prop-2-enylpyrimidin-5-yl)-4-methyl-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(1,3-diethyl-2,4-dioxo-6-prop-2-enylpyrimidin-5-yl)-4-methyl-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 102169281 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-(1,3-diethyl-2,4-dioxo-6-prop-2-enylpyrimidin-5-yl)-4-methyl-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(c1c(CC=C)n(CC)c(=O)n(CC)c1=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-6-10-18-19(20(25)23(9-4)21(26)22(18)8-3)24(15-7-2)29(27,28)17-13-11-16(5)12-14-17/h2,6,11-14H,1,8-10,15H2,3-5H3 |
| InChIKey | VXEOGDMGMVQTAN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|