C22H20N6O3S — CID 10216956
6-benzyl-1-(4-sulfamoylphenyl)-4,5-dihydropyrazolo[5,4-e]indazole-3-carboxamide (PubChem CID 10216956) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 6-benzyl-1-(4-sulfamoylphenyl)-4,5-dihydropyrazolo[5,4-e]indazole-3-carboxamide.
| Compound Name | 6-benzyl-1-(4-sulfamoylphenyl)-4,5-dihydropyrazolo[5,4-e]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10216956 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 6-benzyl-1-(4-sulfamoylphenyl)-4,5-dihydropyrazolo[5,4-e]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(S(N)(=O)=O)cc2)c2c1CCc1c-2cnn1Cc1ccccc1 |
| InChI | InChI=1S/C22H20N6O3S/c23-22(29)20-17-10-11-19-18(12-25-27(19)13-14-4-2-1-3-5-14)21(17)28(26-20)15-6-8-16(9-7-15)32(24,30)31/h1-9,12H,10-11,13H2,(H2,23,29)(H2,24,30,31) |
| InChIKey | UJINJXNOUOBKPJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |