C16H14N2 — CID 102170030
tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-diamine (PubChem CID 102170030) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-diamine.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-diamine |
|---|---|
| PubChem CID | 102170030 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-diamine |
| SMILES | Nc1ccc2c(c1)CCc1cc(N)ccc1C#C2 |
| InChI | InChI=1S/C16H14N2/c17-15-7-5-11-1-2-12-6-8-16(18)10-14(12)4-3-13(11)9-15/h5-10H,3-4,17-18H2 |
| InChIKey | OHRQXWNYOWIKAS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|