C18H14F5NO2 — CID 102170286
(3aS,4S,9bR)-8-methoxy-4-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 102170286) has the molecular formula C18H14F5NO2 and a molecular weight of 371.31 g/mol. Its IUPAC name is (3aS,4S,9bR)-8-methoxy-4-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4S,9bR)-8-methoxy-4-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 102170286 |
| Molecular Formula | C18H14F5NO2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (3aS,4S,9bR)-8-methoxy-4-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | COc1ccc2c(c1)[C@@H]1OCC[C@H]1[C@@H](c1c(F)c(F)c(F)c(F)c1F)N2 |
| InChI | InChI=1S/C18H14F5NO2/c1-25-7-2-3-10-9(6-7)18-8(4-5-26-18)17(24-10)11-12(19)14(21)16(23)15(22)13(11)20/h2-3,6,8,17-18,24H,4-5H2,1H3/t8-,17-,18+/m0/s1 |
| InChIKey | KPSTUJDJHVKTNF-XQZXKKADSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|