C22H25NO3 — CID 102170775
(4S)-2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 102170775) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (4S)-2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102170775 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (4S)-2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | COc1ccc(/C=C/c2ccccc2C2=N[C@@H](C(C)C)CO2)cc1OC |
| InChI | InChI=1S/C22H25NO3/c1-15(2)19-14-26-22(23-19)18-8-6-5-7-17(18)11-9-16-10-12-20(24-3)21(13-16)25-4/h5-13,15,19H,14H2,1-4H3/b11-9+/t19-/m1/s1 |
| InChIKey | YMYYTVZKFQVCSU-SINXNMPMSA-N |
| XLogP | 4.68 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|