C13H22N2O — CID 102170862
(5R,7aS)-2-tert-butyl-5-prop-2-enyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one (PubChem CID 102170862) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (5R,7aS)-2-tert-butyl-5-prop-2-enyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one.
| Compound Name | (5R,7aS)-2-tert-butyl-5-prop-2-enyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
|---|---|
| PubChem CID | 102170862 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (5R,7aS)-2-tert-butyl-5-prop-2-enyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
| SMILES | C=CC[C@H]1CC[C@H]2CN(C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C13H22N2O/c1-5-6-10-7-8-11-9-14(13(2,3)4)12(16)15(10)11/h5,10-11H,1,6-9H2,2-4H3/t10-,11-/m0/s1 |
| InChIKey | HJYQUULDXYVCKS-QWRGUYRKSA-N |
| XLogP | 2.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|