C11H16O2S — CID 102171022
2-(hydroxymethyl)-1-thiophen-2-ylhexan-1-one (PubChem CID 102171022) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-thiophen-2-ylhexan-1-one.
| Compound Name | 2-(hydroxymethyl)-1-thiophen-2-ylhexan-1-one |
|---|---|
| PubChem CID | 102171022 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(hydroxymethyl)-1-thiophen-2-ylhexan-1-one |
| SMILES | CCCCC(CO)C(=O)c1cccs1 |
| InChI | InChI=1S/C11H16O2S/c1-2-3-5-9(8-12)11(13)10-6-4-7-14-10/h4,6-7,9,12H,2-3,5,8H2,1H3 |
| InChIKey | WZINGZMZJSEWOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |