C26H26N4O4 — CID 10217110
2-[[4-[4-[(E)-3-(dimethylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]phenoxy]phenyl]methyl]propanediamide (PubChem CID 10217110) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[[4-[4-[(E)-3-(dimethylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]phenoxy]phenyl]methyl]propanediamide.
| Compound Name | 2-[[4-[4-[(E)-3-(dimethylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]phenoxy]phenyl]methyl]propanediamide |
|---|---|
| PubChem CID | 10217110 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[[4-[4-[(E)-3-(dimethylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]phenoxy]phenyl]methyl]propanediamide |
| SMILES | CN(C)C(=O)/C(=C/c1cccnc1)c1ccc(Oc2ccc(CC(C(N)=O)C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O4/c1-30(2)26(33)22(15-18-4-3-13-29-16-18)19-7-11-21(12-8-19)34-20-9-5-17(6-10-20)14-23(24(27)31)25(28)32/h3-13,15-16,23H,14H2,1-2H3,(H2,27,31)(H2,28,32)/b22-15+ |
| InChIKey | HRGXHHQOSLOSHN-PXLXIMEGSA-N |
| XLogP | 2.63 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|