C28H30O4 — CID 102171527
dibenzyl (3aR,7aS)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate (PubChem CID 102171527) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is dibenzyl (3aR,7aS)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate.
| Compound Name | dibenzyl (3aR,7aS)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102171527 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | dibenzyl (3aR,7aS)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate |
| SMILES | CC(C)=C1CC=C[C@@H]2CC(C(=O)OCc3ccccc3)(C(=O)OCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C28H30O4/c1-20(2)24-15-9-14-23-16-28(17-25(23)24,26(29)31-18-21-10-5-3-6-11-21)27(30)32-19-22-12-7-4-8-13-22/h3-14,23,25H,15-19H2,1-2H3/t23-,25-/m1/s1 |
| InChIKey | PDFGHVMLXWDJQK-ILBGXUMGSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|