About 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide
5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide (PubChem CID 10217166) has the molecular formula C24H23Cl3N2O
and a molecular weight of 461.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide |
| PubChem CID | 10217166 |
| Molecular Formula | C24H23Cl3N2O |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide |
| SMILES | CCCCCCNC(=O)c1cnc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H23Cl3N2O/c1-2-3-4-5-12-28-24(30)17-13-21(16-6-8-18(25)9-7-16)23(29-15-17)20-11-10-19(26)14-22(20)27/h6-11,13-15H,2-5,12H2,1H3,(H,28,30) |
| InChIKey | HSDHYQYLBBAZAZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide (CID 10217166) is 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide is CCCCCCNC(=O)c1cnc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1.
What is the InChIKey of 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide?
The InChIKey is HSDHYQYLBBAZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23Cl3N2O/c1-2-3-4-5-12-28-24(30)17-13-21(16-6-8-18(25)9-7-16)23(29-15-17)20-11-10-19(26)14-22(20)27/h6-11,13-15H,2-5,12H2,1H3,(H,28,30).
What are the key properties of 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide?
5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide has a molecular weight of 461.82 g/mol, XLogP of 7.69, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-N-hexylpyridine-3-carboxamide is sourced from PubChem (CID 10217166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).