C21H14ClNO — CID 102171684
2-(3-chlorophenyl)-1-phenylquinolin-4-one (PubChem CID 102171684) has the molecular formula C21H14ClNO and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-phenylquinolin-4-one.
| Compound Name | 2-(3-chlorophenyl)-1-phenylquinolin-4-one |
|---|---|
| PubChem CID | 102171684 |
| Molecular Formula | C21H14ClNO |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(3-chlorophenyl)-1-phenylquinolin-4-one |
| SMILES | O=c1cc(-c2cccc(Cl)c2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H14ClNO/c22-16-8-6-7-15(13-16)20-14-21(24)18-11-4-5-12-19(18)23(20)17-9-2-1-3-10-17/h1-14H |
| InChIKey | BSSCEVIJOROUCZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |