C22H19NO4S2 — CID 102171790
6-(1,3-benzodioxol-5-yl)-3-(1,3-dithiolan-2-ylidene)-1-(4-methylphenyl)piperidine-2,4-dione (PubChem CID 102171790) has the molecular formula C22H19NO4S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3-(1,3-dithiolan-2-ylidene)-1-(4-methylphenyl)piperidine-2,4-dione.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3-(1,3-dithiolan-2-ylidene)-1-(4-methylphenyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 102171790 |
| Molecular Formula | C22H19NO4S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3-(1,3-dithiolan-2-ylidene)-1-(4-methylphenyl)piperidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)C(=C3SCCS3)C(=O)CC2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H19NO4S2/c1-13-2-5-15(6-3-13)23-16(14-4-7-18-19(10-14)27-12-26-18)11-17(24)20(21(23)25)22-28-8-9-29-22/h2-7,10,16H,8-9,11-12H2,1H3 |
| InChIKey | NFDZBSWNWIFVDY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|