C18H20F9NO2 — CID 102171909
tert-butyl N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]carbamate (PubChem CID 102171909) has the molecular formula C18H20F9NO2 and a molecular weight of 453.35 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 102171909 |
| Molecular Formula | C18H20F9NO2 |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H20F9NO2/c1-14(2,3)30-13(29)28-12(10-9-11-7-5-4-6-8-11)15(19,20)16(21,22)17(23,24)18(25,26)27/h4-8,12H,9-10H2,1-3H3,(H,28,29)/t12-/m1/s1 |
| InChIKey | NYAYNGHQZYHJGO-GFCCVEGCSA-N |
| XLogP | 5.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|