C23H38OSi2 — CID 102172162
2,5-bis[tert-butyl(dimethyl)silyl]-5-deuterio-1-phenylpenta-2,3,4-trien-1-ol (PubChem CID 102172162) has the molecular formula C23H38OSi2 and a molecular weight of 387.73 g/mol. Its IUPAC name is 2,5-bis[tert-butyl(dimethyl)silyl]-5-deuterio-1-phenylpenta-2,3,4-trien-1-ol.
| Compound Name | 2,5-bis[tert-butyl(dimethyl)silyl]-5-deuterio-1-phenylpenta-2,3,4-trien-1-ol |
|---|---|
| PubChem CID | 102172162 |
| Molecular Formula | C23H38OSi2 |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2,5-bis[tert-butyl(dimethyl)silyl]-5-deuterio-1-phenylpenta-2,3,4-trien-1-ol |
| SMILES | [2H]C(=C=C=C(C(O)c1ccccc1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38OSi2/c1-22(2,3)25(7,8)18-14-17-20(26(9,10)23(4,5)6)21(24)19-15-12-11-13-16-19/h11-13,15-16,18,21,24H,1-10H3/b20-18-/i18D |
| InChIKey | JHGOYGXVAQGHHC-WIZSGJJXSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|