C16H32O2Si — CID 102172214
(1S,2E,3R)-1-cyclohexyl-4-methyl-2-(trimethylsilylmethylidene)pentane-1,3-diol (PubChem CID 102172214) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (1S,2E,3R)-1-cyclohexyl-4-methyl-2-(trimethylsilylmethylidene)pentane-1,3-diol.
| Compound Name | (1S,2E,3R)-1-cyclohexyl-4-methyl-2-(trimethylsilylmethylidene)pentane-1,3-diol |
|---|---|
| PubChem CID | 102172214 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (1S,2E,3R)-1-cyclohexyl-4-methyl-2-(trimethylsilylmethylidene)pentane-1,3-diol |
| SMILES | CC(C)[C@@H](O)/C(=C\[Si](C)(C)C)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C16H32O2Si/c1-12(2)15(17)14(11-19(3,4)5)16(18)13-9-7-6-8-10-13/h11-13,15-18H,6-10H2,1-5H3/b14-11+/t15-,16+/m1/s1 |
| InChIKey | IAGWEWUQRNAXOW-MEDRYPNSSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|