C17H18S2 — CID 102172596
tricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaene-5,15-dithiol (PubChem CID 102172596) has the molecular formula C17H18S2 and a molecular weight of 286.47 g/mol. Its IUPAC name is tricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaene-5,15-dithiol.
| Compound Name | tricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaene-5,15-dithiol |
|---|---|
| PubChem CID | 102172596 |
| Molecular Formula | C17H18S2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | tricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaene-5,15-dithiol |
| SMILES | Sc1ccc2c(c1)CCCCCc1cc(S)ccc1-2 |
| InChI | InChI=1S/C17H18S2/c18-14-6-8-16-12(10-14)4-2-1-3-5-13-11-15(19)7-9-17(13)16/h6-11,18-19H,1-5H2 |
| InChIKey | LYHJNLBPJLHOGW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|