C25H32N4O3S — CID 10217275
N-cyclohexyl-1-(5-hydroxypentyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide (PubChem CID 10217275) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-cyclohexyl-1-(5-hydroxypentyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide.
| Compound Name | N-cyclohexyl-1-(5-hydroxypentyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10217275 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-cyclohexyl-1-(5-hydroxypentyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1cccs1)n2CCCCCO)C1CCCCC1 |
| InChI | InChI=1S/C25H32N4O3S/c1-28(19-9-4-2-5-10-19)24(32)18-12-13-21-20(17-18)26-25(29(21)14-6-3-7-15-30)27-23(31)22-11-8-16-33-22/h8,11-13,16-17,19,30H,2-7,9-10,14-15H2,1H3,(H,26,27,31) |
| InChIKey | NVXUMCIXZKVIJC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|