C17H19NO6 — CID 102173192
methyl (3aS,4R,6S,7S,7aR)-7a-methyl-4-nitro-2-oxo-7-phenyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-6-carboxylate (PubChem CID 102173192) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl (3aS,4R,6S,7S,7aR)-7a-methyl-4-nitro-2-oxo-7-phenyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-6-carboxylate.
| Compound Name | methyl (3aS,4R,6S,7S,7aR)-7a-methyl-4-nitro-2-oxo-7-phenyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 102173192 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl (3aS,4R,6S,7S,7aR)-7a-methyl-4-nitro-2-oxo-7-phenyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-6-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]([N+](=O)[O-])[C@@H]2CC(=O)O[C@]2(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-17-12(9-14(19)24-17)13(18(21)22)8-11(16(20)23-2)15(17)10-6-4-3-5-7-10/h3-7,11-13,15H,8-9H2,1-2H3/t11-,12-,13+,15+,17-/m0/s1 |
| InChIKey | RKKMYQOLCGTXSB-SCYMPEOESA-N |
| XLogP | 1.93 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|