C11H16N2O2 — CID 102173262
2-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-1H-pyrimidin-6-one (PubChem CID 102173262) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 102173262 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc([C@@H]2CCCC[C@H]2CO)[nH]1 |
| InChI | InChI=1S/C11H16N2O2/c14-7-8-3-1-2-4-9(8)11-12-6-5-10(15)13-11/h5-6,8-9,14H,1-4,7H2,(H,12,13,15)/t8-,9+/m0/s1 |
| InChIKey | NGVNHYZKXUXWQZ-DTWKUNHWSA-N |
| XLogP | 1.04 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |