C15H18N2O — CID 102174177
(1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-trien-6-one (PubChem CID 102174177) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-trien-6-one.
| Compound Name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-trien-6-one |
|---|---|
| PubChem CID | 102174177 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-trien-6-one |
| SMILES | O=C1C=CC[C@@H]2[C@H]3CC=CN4C=CC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C15H18N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1-3,7-9,11-13,15H,4-6,10H2/t11-,12+,13+,15-/m0/s1 |
| InChIKey | JELULWJOLQGHIR-JLNYLFASSA-N |
| XLogP | 1.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |