C19H15NO2S — CID 102174341
1-methylsulfanyl-6,7-dihydro-5H-naphtho[3,2-d][3]benzazepine-8,13-dione (PubChem CID 102174341) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-methylsulfanyl-6,7-dihydro-5H-naphtho[3,2-d][3]benzazepine-8,13-dione.
| Compound Name | 1-methylsulfanyl-6,7-dihydro-5H-naphtho[3,2-d][3]benzazepine-8,13-dione |
|---|---|
| PubChem CID | 102174341 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-methylsulfanyl-6,7-dihydro-5H-naphtho[3,2-d][3]benzazepine-8,13-dione |
| SMILES | CSc1cccc2c1C1=C(NCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15NO2S/c1-23-14-8-4-5-11-9-10-20-17-16(15(11)14)18(21)12-6-2-3-7-13(12)19(17)22/h2-8,20H,9-10H2,1H3 |
| InChIKey | HWAZRCJNEUDPLZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|