About [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate
[(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate (PubChem CID 102174480) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate.
Molecular Properties
| Compound Name | [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate |
| PubChem CID | 102174480 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate |
| SMILES | COC(=O)OC[C@H]1C=CC=C[C@H]1COC(=O)OC |
| InChI | InChI=1S/C12H16O6/c1-15-11(13)17-7-9-5-3-4-6-10(9)8-18-12(14)16-2/h3-6,9-10H,7-8H2,1-2H3/t9-,10+ |
| InChIKey | HZTZKMIVQBBERB-AOOOYVTPSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate?
The IUPAC name of [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate (CID 102174480) is [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate.
What is the SMILES notation for [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate?
The canonical SMILES for [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate is COC(=O)OC[C@H]1C=CC=C[C@H]1COC(=O)OC.
What is the InChIKey of [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate?
The InChIKey is HZTZKMIVQBBERB-AOOOYVTPSA-N. The full InChI is InChI=1S/C12H16O6/c1-15-11(13)17-7-9-5-3-4-6-10(9)8-18-12(14)16-2/h3-6,9-10H,7-8H2,1-2H3/t9-,10+.
What are the key properties of [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate?
[(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate has a molecular weight of 256.25 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,6R)-6-(methoxycarbonyloxymethyl)cyclohexa-2,4-dien-1-yl]methyl methyl carbonate is sourced from PubChem (CID 102174480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).