C39H75N5O12S — CID 102174509
1-[2-[2-[2-[2-[2-[2-[2-(4-decyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-[6-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]thiourea (PubChem CID 102174509) has the molecular formula C39H75N5O12S and a molecular weight of 838.12 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2-[2-[2-(4-decyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-[6-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]thiourea.
| Compound Name | 1-[2-[2-[2-[2-[2-[2-[2-(4-decyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-[6-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]thiourea |
|---|---|
| PubChem CID | 102174509 |
| Molecular Formula | C39H75N5O12S |
| Molecular Weight | 838.12 g/mol |
| Exact Mass | 837.51 |
| IUPAC Name | 1-[2-[2-[2-[2-[2-[2-[2-(4-decyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-[6-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]thiourea |
| SMILES | CCCCCCCCCCc1cn(CCOCCOCCOCCOCCOCCOCCNC(=S)NCCCCCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C39H75N5O12S/c1-2-3-4-5-6-7-8-11-14-33-31-44(43-42-33)17-20-50-22-24-52-26-28-54-30-29-53-27-25-51-23-21-49-19-16-41-39(57)40-15-12-9-10-13-18-55-38-37(48)36(47)35(46)34(32-45)56-38/h31,34-38,45-48H,2-30,32H2,1H3,(H2,40,41,57)/t34-,35-,36+,37+,38+/m1/s1 |
| InChIKey | PSUGKGJLOZMLTB-DSVGPAFQSA-N |
| XLogP | 1.90 |
| TPSA | 209.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|