C26H35F5N4O6S — CID 102174781
methyl 2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetate (PubChem CID 102174781) has the molecular formula C26H35F5N4O6S and a molecular weight of 626.65 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 102174781 |
| Molecular Formula | C26H35F5N4O6S |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | methyl 2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetate |
| SMILES | COC(=O)CN(CCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H35F5N4O6S/c1-39-19(37)13-35(12-15-20(27)22(29)24(31)23(30)21(15)28)7-9-41-11-10-40-8-6-32-18(36)5-3-2-4-17-25-16(14-42-17)33-26(38)34-25/h16-17,25H,2-14H2,1H3,(H,32,36)(H2,33,34,38) |
| InChIKey | PSFXJUZZPCVNCQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|