About methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate
methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate (PubChem CID 102174960) has the molecular formula C27H18FNO4
and a molecular weight of 439.44 g/mol. Its IUPAC name is methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate.
Molecular Properties
| Compound Name | methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate |
| PubChem CID | 102174960 |
| Molecular Formula | C27H18FNO4 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc3c(c2)OCO3)cc(-c2ccc(F)cc2)n2c1cc1ccccc12 |
| InChI | InChI=1S/C27H18FNO4/c1-31-27(30)26-20(17-8-11-24-25(13-17)33-15-32-24)14-22(16-6-9-19(28)10-7-16)29-21-5-3-2-4-18(21)12-23(26)29/h2-14H,15H2,1H3 |
| InChIKey | YDOXGBIFBWXSGJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate?
The IUPAC name of methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate (CID 102174960) is methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate.
What is the SMILES notation for methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate?
The canonical SMILES for methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate is COC(=O)c1c(-c2ccc3c(c2)OCO3)cc(-c2ccc(F)cc2)n2c1cc1ccccc12.
What is the InChIKey of methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate?
The InChIKey is YDOXGBIFBWXSGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18FNO4/c1-31-27(30)26-20(17-8-11-24-25(13-17)33-15-32-24)14-22(16-6-9-19(28)10-7-16)29-21-5-3-2-4-18(21)12-23(26)29/h2-14H,15H2,1H3.
What are the key properties of methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate?
methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate has a molecular weight of 439.44 g/mol, XLogP of 6.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)pyrido[1,2-a]indole-9-carboxylate is sourced from PubChem (CID 102174960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).