About (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine
(3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine (PubChem CID 102175146) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine.
Molecular Properties
| Compound Name | (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine |
| PubChem CID | 102175146 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine |
| SMILES | C=CCN[C@H]1[C@H](OC)COC1(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-6-11-9-8(12-4)7-13-10(9,2)3/h5,8-9,11H,1,6-7H2,2-4H3/t8-,9+/m1/s1 |
| InChIKey | BTBKUVCADFBGBS-BDAKNGLRSA-N |
| XLogP | 0.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine?
The IUPAC name of (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine (CID 102175146) is (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine.
What is the SMILES notation for (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine?
The canonical SMILES for (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine is C=CCN[C@H]1[C@H](OC)COC1(C)C.
What is the InChIKey of (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine?
The InChIKey is BTBKUVCADFBGBS-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-6-11-9-8(12-4)7-13-10(9,2)3/h5,8-9,11H,1,6-7H2,2-4H3/t8-,9+/m1/s1.
What are the key properties of (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine?
(3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine has a molecular weight of 185.27 g/mol, XLogP of 0.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-methoxy-2,2-dimethyl-N-prop-2-enyloxolan-3-amine is sourced from PubChem (CID 102175146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).