C15H16N2O4S — CID 102176428
methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]acetate (PubChem CID 102176428) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]acetate.
| Compound Name | methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]acetate |
|---|---|
| PubChem CID | 102176428 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]acetate |
| SMILES | COC(=O)CN1CC(=O)N2[C@@H](c3ccccc3)SC[C@H]2C1=O |
| InChI | InChI=1S/C15H16N2O4S/c1-21-13(19)8-16-7-12(18)17-11(14(16)20)9-22-15(17)10-5-3-2-4-6-10/h2-6,11,15H,7-9H2,1H3/t11-,15+/m0/s1 |
| InChIKey | WKSNFSGTDPKHJU-XHDPSFHLSA-N |
| XLogP | 0.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |