C31H28F6N2O8 — CID 102177403
(2S,3S)-2-[5-[2-[2-[(1S,2S)-1-carboxy-2-methylbutyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-3-methylpentanoic acid (PubChem CID 102177403) has the molecular formula C31H28F6N2O8 and a molecular weight of 670.56 g/mol. Its IUPAC name is (2S,3S)-2-[5-[2-[2-[(1S,2S)-1-carboxy-2-methylbutyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[5-[2-[2-[(1S,2S)-1-carboxy-2-methylbutyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 102177403 |
| Molecular Formula | C31H28F6N2O8 |
| Molecular Weight | 670.56 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | (2S,3S)-2-[5-[2-[2-[(1S,2S)-1-carboxy-2-methylbutyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N1C(=O)c2ccc(C(c3ccc4c(c3)C(=O)N([C@H](C(=O)O)[C@@H](C)CC)C4=O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C31H28F6N2O8/c1-5-13(3)21(27(44)45)38-23(40)17-9-7-15(11-19(17)25(38)42)29(30(32,33)34,31(35,36)37)16-8-10-18-20(12-16)26(43)39(24(18)41)22(28(46)47)14(4)6-2/h7-14,21-22H,5-6H2,1-4H3,(H,44,45)(H,46,47)/t13-,14-,21-,22-/m0/s1 |
| InChIKey | YHIBPXRGDIYQMD-WJWAULOUSA-N |
| XLogP | 5.29 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|