About methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate
methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate (PubChem CID 102177846) has the molecular formula C11H12O5
and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate |
| PubChem CID | 102177846 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C=C(O)/C=C1\OC(=O)C(C)=C1C |
| InChI | InChI=1S/C11H12O5/c1-6-7(2)11(14)16-9(6)4-8(12)5-10(13)15-3/h4-5,12H,1-3H3/b8-5-,9-4- |
| InChIKey | KMPTZTOOZXHPBW-QWUBYWPLSA-N |
| XLogP | 1.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate?
The IUPAC name of methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate (CID 102177846) is methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate.
What is the SMILES notation for methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate?
The canonical SMILES for methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate is COC(=O)/C=C(O)/C=C1\OC(=O)C(C)=C1C.
What is the InChIKey of methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate?
The InChIKey is KMPTZTOOZXHPBW-QWUBYWPLSA-N. The full InChI is InChI=1S/C11H12O5/c1-6-7(2)11(14)16-9(6)4-8(12)5-10(13)15-3/h4-5,12H,1-3H3/b8-5-,9-4-.
What are the key properties of methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate?
methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate has a molecular weight of 224.21 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate is sourced from PubChem (CID 102177846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).