About (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene
(2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene (PubChem CID 102177919) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene |
| PubChem CID | 102177919 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene |
| SMILES | COC[C@@H]1SC(C(C)C)C=C1C |
| InChI | InChI=1S/C10H18OS/c1-7(2)9-5-8(3)10(12-9)6-11-4/h5,7,9-10H,6H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | OAQDZPBNIKRVND-AXDSSHIGSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene?
The IUPAC name of (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene (CID 102177919) is (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene.
What is the SMILES notation for (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene?
The canonical SMILES for (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene is COC[C@@H]1SC(C(C)C)C=C1C.
What is the InChIKey of (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene?
The InChIKey is OAQDZPBNIKRVND-AXDSSHIGSA-N. The full InChI is InChI=1S/C10H18OS/c1-7(2)9-5-8(3)10(12-9)6-11-4/h5,7,9-10H,6H2,1-4H3/t9?,10-/m0/s1.
What are the key properties of (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene?
(2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene has a molecular weight of 186.32 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(methoxymethyl)-3-methyl-5-propan-2-yl-2,5-dihydrothiophene is sourced from PubChem (CID 102177919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).