C21H27NO8 — CID 102178556
[(2R,3R,4R,5S)-1-acetyl-3,5-diacetyloxy-4-phenylmethoxypiperidin-2-yl]methyl acetate (PubChem CID 102178556) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1-acetyl-3,5-diacetyloxy-4-phenylmethoxypiperidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-1-acetyl-3,5-diacetyloxy-4-phenylmethoxypiperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102178556 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [(2R,3R,4R,5S)-1-acetyl-3,5-diacetyloxy-4-phenylmethoxypiperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OC(C)=O)CN1C(C)=O |
| InChI | InChI=1S/C21H27NO8/c1-13(23)22-10-19(29-15(3)25)21(28-11-17-8-6-5-7-9-17)20(30-16(4)26)18(22)12-27-14(2)24/h5-9,18-21H,10-12H2,1-4H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | HFWITGFTJXUVFV-PLACYPQZSA-N |
| XLogP | 1.23 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|