C16H23NO9 — CID 102178557
[(2R,3R,4R,5S)-1-acetyl-3,4,5-triacetyloxypiperidin-2-yl]methyl acetate (PubChem CID 102178557) has the molecular formula C16H23NO9 and a molecular weight of 373.36 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1-acetyl-3,4,5-triacetyloxypiperidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-1-acetyl-3,4,5-triacetyloxypiperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102178557 |
| Molecular Formula | C16H23NO9 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [(2R,3R,4R,5S)-1-acetyl-3,4,5-triacetyloxypiperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)CN1C(C)=O |
| InChI | InChI=1S/C16H23NO9/c1-8(18)17-6-14(24-10(3)20)16(26-12(5)22)15(25-11(4)21)13(17)7-23-9(2)19/h13-16H,6-7H2,1-5H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | UWAXKEPCPIIJKB-QKPAOTATSA-N |
| XLogP | -0.42 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|