C28H43NO5S — CID 10217872
[(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3Z)-3-hydroxyiminocyclohexyl]sulfanylacetate (PubChem CID 10217872) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3Z)-3-hydroxyiminocyclohexyl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3Z)-3-hydroxyiminocyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 10217872 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3Z)-3-hydroxyiminocyclohexyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC2CCC/C(=N/O)C2)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H43NO5S/c1-6-26(4)15-22(34-23(31)16-35-20-9-7-8-19(14-20)29-33)27(5)17(2)10-12-28(18(3)25(26)32)13-11-21(30)24(27)28/h6,17-18,20,22,24-25,32-33H,1,7-16H2,2-5H3/b29-19-/t17-,18+,20?,22-,24?,25+,26-,27+,28+/m1/s1 |
| InChIKey | YEPCKAPVWIJUDW-CCVISQOMSA-N |
| XLogP | 5.40 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|