C14H8O6S4 — CID 102178826
dimethyl 2-(4,7-dioxo-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102178826) has the molecular formula C14H8O6S4 and a molecular weight of 400.48 g/mol. Its IUPAC name is dimethyl 2-(4,7-dioxo-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(4,7-dioxo-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102178826 |
| Molecular Formula | C14H8O6S4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | dimethyl 2-(4,7-dioxo-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(S2)C(=O)C=CC3=O)S1 |
| InChI | InChI=1S/C14H8O6S4/c1-19-11(17)9-10(12(18)20-2)24-14(23-9)13-21-7-5(15)3-4-6(16)8(7)22-13/h3-4H,1-2H3 |
| InChIKey | ZNRSUIKCFDQQGY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|