C18H24N2O3 — CID 102179434
tert-butyl N-(1-benzyl-7-oxo-3,4-dihydro-2H-azepin-6-yl)carbamate (PubChem CID 102179434) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl N-(1-benzyl-7-oxo-3,4-dihydro-2H-azepin-6-yl)carbamate.
| Compound Name | tert-butyl N-(1-benzyl-7-oxo-3,4-dihydro-2H-azepin-6-yl)carbamate |
|---|---|
| PubChem CID | 102179434 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl N-(1-benzyl-7-oxo-3,4-dihydro-2H-azepin-6-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=CCCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)23-17(22)19-15-11-7-8-12-20(16(15)21)13-14-9-5-4-6-10-14/h4-6,9-11H,7-8,12-13H2,1-3H3,(H,19,22) |
| InChIKey | PVWDHPIUCCMDEQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |