C26H36N2O2 — CID 102179628
(1S,2S,5S)-3-[2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]phenyl]imino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (PubChem CID 102179628) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (1S,2S,5S)-3-[2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]phenyl]imino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
| Compound Name | (1S,2S,5S)-3-[2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]phenyl]imino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
|---|---|
| PubChem CID | 102179628 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (1S,2S,5S)-3-[2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]phenyl]imino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2C/C(=N/c3ccccc3/N=C3\C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O)[C@@](C)(O)[C@H]1C2 |
| InChI | InChI=1S/C26H36N2O2/c1-23(2)15-11-19(23)25(5,29)21(13-15)27-17-9-7-8-10-18(17)28-22-14-16-12-20(24(16,3)4)26(22,6)30/h7-10,15-16,19-20,29-30H,11-14H2,1-6H3/b27-21-,28-22+/t15-,16-,19-,20-,25-,26-/m0/s1 |
| InChIKey | FDTJOHWOLCOMDG-UTOCNEABSA-N |
| XLogP | 5.47 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|