C24H33N3O4S — CID 102179801
dimethyl 1,4-ditert-butyl-6-phenylimino-7-thia-1,4-diazaspiro[4.4]non-8-ene-8,9-dicarboxylate (PubChem CID 102179801) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is dimethyl 1,4-ditert-butyl-6-phenylimino-7-thia-1,4-diazaspiro[4.4]non-8-ene-8,9-dicarboxylate.
| Compound Name | dimethyl 1,4-ditert-butyl-6-phenylimino-7-thia-1,4-diazaspiro[4.4]non-8-ene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 102179801 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | dimethyl 1,4-ditert-butyl-6-phenylimino-7-thia-1,4-diazaspiro[4.4]non-8-ene-8,9-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(/C(=N/c3ccccc3)S1)N(C(C)(C)C)CCN2C(C)(C)C |
| InChI | InChI=1S/C24H33N3O4S/c1-22(2,3)26-14-15-27(23(4,5)6)24(26)17(19(28)30-7)18(20(29)31-8)32-21(24)25-16-12-10-9-11-13-16/h9-13H,14-15H2,1-8H3/b25-21- |
| InChIKey | ARCYHNNDBQOUAB-DAFNUICNSA-N |
| XLogP | 3.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|