About 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol
3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol (PubChem CID 102179946) has the molecular formula C23H15F2NO
and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol.
Molecular Properties
| Compound Name | 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol |
| PubChem CID | 102179946 |
| Molecular Formula | C23H15F2NO |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol |
| SMILES | Oc1cccc(-c2cc(-c3cccc(F)c3)nc(-c3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C23H15F2NO/c24-19-7-1-5-16(10-19)22-13-18(15-4-3-9-21(27)12-15)14-23(26-22)17-6-2-8-20(25)11-17/h1-14,27H |
| InChIKey | PZYBXYCCUXWSRW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol?
The IUPAC name of 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol (CID 102179946) is 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol.
What is the SMILES notation for 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol?
The canonical SMILES for 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol is Oc1cccc(-c2cc(-c3cccc(F)c3)nc(-c3cccc(F)c3)c2)c1.
What is the InChIKey of 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol?
The InChIKey is PZYBXYCCUXWSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2NO/c24-19-7-1-5-16(10-19)22-13-18(15-4-3-9-21(27)12-15)14-23(26-22)17-6-2-8-20(25)11-17/h1-14,27H.
What are the key properties of 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol?
3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol has a molecular weight of 359.38 g/mol, XLogP of 6.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-bis(3-fluorophenyl)-4-pyridinyl]phenol is sourced from PubChem (CID 102179946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).