C19H30O5 — CID 102180152
dimethyl 2-[(E)-6-hydroxy-3,7,7-trimethyloct-2-enyl]-2-prop-2-ynylpropanedioate (PubChem CID 102180152) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is dimethyl 2-[(E)-6-hydroxy-3,7,7-trimethyloct-2-enyl]-2-prop-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[(E)-6-hydroxy-3,7,7-trimethyloct-2-enyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 102180152 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | dimethyl 2-[(E)-6-hydroxy-3,7,7-trimethyloct-2-enyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C(\C)CCC(O)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H30O5/c1-8-12-19(16(21)23-6,17(22)24-7)13-11-14(2)9-10-15(20)18(3,4)5/h1,11,15,20H,9-10,12-13H2,2-7H3/b14-11+ |
| InChIKey | OVJXYFSYAXZMDI-SDNWHVSQSA-N |
| XLogP | 2.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|