About 1-(4-chlorophenyl)selanylethenyl-trimethylsilane
1-(4-chlorophenyl)selanylethenyl-trimethylsilane (PubChem CID 102180187) has the molecular formula C11H15ClSeSi
and a molecular weight of 289.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)selanylethenyl-trimethylsilane.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)selanylethenyl-trimethylsilane |
| PubChem CID | 102180187 |
| Molecular Formula | C11H15ClSeSi |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 1-(4-chlorophenyl)selanylethenyl-trimethylsilane |
| SMILES | C=C([Se]c1ccc(Cl)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C11H15ClSeSi/c1-9(14(2,3)4)13-11-7-5-10(12)6-8-11/h5-8H,1H2,2-4H3 |
| InChIKey | QLNJSICPNUIRKL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)selanylethenyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)selanylethenyl-trimethylsilane?
The IUPAC name of 1-(4-chlorophenyl)selanylethenyl-trimethylsilane (CID 102180187) is 1-(4-chlorophenyl)selanylethenyl-trimethylsilane.
What is the SMILES notation for 1-(4-chlorophenyl)selanylethenyl-trimethylsilane?
The canonical SMILES for 1-(4-chlorophenyl)selanylethenyl-trimethylsilane is C=C([Se]c1ccc(Cl)cc1)[Si](C)(C)C.
What is the InChIKey of 1-(4-chlorophenyl)selanylethenyl-trimethylsilane?
The InChIKey is QLNJSICPNUIRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClSeSi/c1-9(14(2,3)4)13-11-7-5-10(12)6-8-11/h5-8H,1H2,2-4H3.
What are the key properties of 1-(4-chlorophenyl)selanylethenyl-trimethylsilane?
1-(4-chlorophenyl)selanylethenyl-trimethylsilane has a molecular weight of 289.74 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)selanylethenyl-trimethylsilane is sourced from PubChem (CID 102180187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).