C22H28O8 — CID 102180268
dimethyl (3aS,7aR)-5-(1-methoxy-2-methoxycarbonyl-1-oxopent-4-en-2-yl)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate (PubChem CID 102180268) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is dimethyl (3aS,7aR)-5-(1-methoxy-2-methoxycarbonyl-1-oxopent-4-en-2-yl)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,7aR)-5-(1-methoxy-2-methoxycarbonyl-1-oxopent-4-en-2-yl)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102180268 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | dimethyl (3aS,7aR)-5-(1-methoxy-2-methoxycarbonyl-1-oxopent-4-en-2-yl)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C=CCC(C(=O)OC)(C(=O)OC)C1=C[C@@H]2C(=C)CC(C(=O)OC)(C(=O)OC)[C@@H]2CC1 |
| InChI | InChI=1S/C22H28O8/c1-7-10-21(17(23)27-3,18(24)28-4)14-8-9-16-15(11-14)13(2)12-22(16,19(25)29-5)20(26)30-6/h7,11,15-16H,1-2,8-10,12H2,3-6H3/t15-,16-/m1/s1 |
| InChIKey | CJFMTBSSLVXTOQ-HZPDHXFCSA-N |
| XLogP | 2.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|